| Compound Information | SONAR Target prediction | | Name: | DEHYDROABIETAMIDE | | Unique Identifier: | SPE00307050 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 270.22 g/mol | | X log p: | 6.033 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CCCC32C)C(N)=O)c1 | | Class: | diterpene | | Source: | derivative |
| Species: |
4932 |
| Condition: |
KAP123 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5574±0.00374767 |
| Normalized OD Score: sc h |
0.9953±0.00331159 |
| Z-Score: |
-0.1936±0.147232 |
| p-Value: |
0.847274 |
| Z-Factor: |
-103.733 |
| Fitness Defect: |
0.1657 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|F4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2007-11-09 YYYY-MM-DD | | Plate CH Control (+): | 0.040575±0.00074 | | Plate DMSO Control (-): | 0.5507±0.01865 | | Plate Z-Factor: | 0.8867 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 3983547 |
1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|