| Compound Information | SONAR Target prediction | | Name: | DEHYDROABIETAMIDE | | Unique Identifier: | SPE00307050 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 270.22 g/mol | | X log p: | 6.033 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(C)c1ccc2c(CCC3C(C)(CCCC32C)C(N)=O)c1 | | Class: | diterpene | | Source: | derivative |
| Species: |
4932 |
| Condition: |
SPE00305025 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4788±0.00494975 |
| Normalized OD Score: sc h |
1.0077±0.00882837 |
| Z-Score: |
0.1803±0.212139 |
| p-Value: |
0.858512 |
| Z-Factor: |
-7.13399 |
| Fitness Defect: |
0.1526 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|F8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.20 Celcius | | Date: | 2006-12-21 YYYY-MM-DD | | Plate CH Control (+): | 0.039175±0.00245 | | Plate DMSO Control (-): | 0.48912500000000003±0.03939 | | Plate Z-Factor: | 0.7639 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 3983547 |
1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7722 | Additional Members: 4 | Rows returned: 1 | |
|
