| Compound Information | SONAR Target prediction | | Name: | 11-OXOURSOLIC ACID ACETATE | | Unique Identifier: | SPE00307045 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H48O5 | | Molecular Weight: | 464.339 g/mol | | X log p: | 0.647 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 60.44 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CC(=O)C4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C2C1C)C(O)=
O | | Source: | ex Bursera delpechiana | | Reference: | Phytochemistry 30: 362 (1991) |
| Species: |
4932 |
| Condition: |
KRE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8158±0.000494975 |
| Normalized OD Score: sc h |
1.0060±0.0038555 |
| Z-Score: |
0.3251±0.204607 |
| p-Value: |
0.747634 |
| Z-Factor: |
-3.97119 |
| Fitness Defect: |
0.2908 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|F2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.40 Celcius | | Date: | 2006-01-31 YYYY-MM-DD | | Plate CH Control (+): | 0.0382±0.00051 | | Plate DMSO Control (-): | 0.7959±0.00913 | | Plate Z-Factor: | 0.9634 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 234102 |
(1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,
6a,7,8,8a,10,11,12,14b-tetradecahydropicene-4a-carboxylic acid |
| 3999708 |
10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicen
e-4a-carboxylic acid |
| 6708658 |
(1S,2R,4aS,6aS,6bR,10S,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,
11,12,14b-tetradecahydropicene-4a-carboxylic acid |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 | |
|
