| 
 | Compound Information | SONAR Target prediction |  | Name: | 11-OXOURSOLIC ACID ACETATE |  | Unique Identifier: | SPE00307045 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H48O5 |  | Molecular Weight: | 464.339 g/mol |  | X log p: | 0.647  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 60.44 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC1CCC2(CCC3(C)C(=CC(=O)C4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C2C1C)C(O)= O
 |  | Source: | ex Bursera delpechiana |  | Reference: | Phytochemistry 30: 362 (1991) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | IDH2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5753±0.000989949 |  
		| Normalized OD Score: sc h | 0.9866±0.00754554 |  
		| Z-Score: | -0.6744±0.394492 |  
		| p-Value: | 0.516452 |  
		| Z-Factor: | -6.93747 |  
		| Fitness Defect: | 0.6608 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|F2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.60 Celcius |  | Date: | 2007-10-19 YYYY-MM-DD |  | Plate CH Control (+): | 0.04015±0.00047 |  | Plate DMSO Control (-): | 0.577125±0.01741 |  | Plate Z-Factor: | 0.8899 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 234102 | (1S,2R,4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6, 6a,7,8,8a,10,11,12,14b-tetradecahydropicene-4a-carboxylic acid
 |  
		| 3999708 | 10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10,11,12,14b-tetradecahydropicen e-4a-carboxylic acid
 |  
		| 6708658 | (1S,2R,4aS,6aS,6bR,10S,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,5,6,6a,7,8,8a,10, 11,12,14b-tetradecahydropicene-4a-carboxylic acid
 |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 1869 | Additional Members: 9 | Rows returned: 3 |  | 
 
 |