| 
 | Compound Information | SONAR Target prediction |  | Name: | 7-OXOCHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307035 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 396.309 g/mol |  | X log p: | 2.529  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(CC1=CC3=O)OC(C)=O |  | Class: | sterol |  | Source: | Cliona copiosa |  | Reference: | J Nat Prod 55:1588 (1992) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | RVS167 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7088±0.0103238 |  
		| Normalized OD Score: sc h | 0.9793±0.014062 |  
		| Z-Score: | -1.1671±0.824101 |  
		| p-Value: | 0.31957 |  
		| Z-Factor: | -8.09302 |  
		| Fitness Defect: | 1.1408 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2007-11-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.0406±0.00058 |  | Plate DMSO Control (-): | 0.7132000000000001±0.02215 |  | Plate Z-Factor: | 0.9438 | 
 |  png ps
 pdf
 | 
 
 
	
		| 101861 | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 287665 | (10-methyl-7-oxo-17-propan-2-yl-2,3,4,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3 -yl) acetate
 |  
		| 287666 | [10,13-dimethyl-17-(6-methylheptan-2-yl)-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-yl] acetate
 |  
		| 536625 | (4,4,10,13-tetramethyl-7-oxo-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate
 |  
		| 540873 | (10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate |  
		| 541078 | (17-acetyl-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate
 |  
 | internal high similarity DBLink  | Rows returned: 2 |  | 
 
 | active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  | 
 
 |