| Compound Information | SONAR Target prediction |  | Name: | 7-OXOCHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307035  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 396.309 g/mol |  | X log p: | 2.529  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(CC1=CC3=O)OC(C)=O |  | Class: | sterol |  | Source: | Cliona copiosa |  | Reference: | J Nat Prod 55:1588 (1992) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RIC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4634±0.0270822 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0348±0.00259181 | 
	 
	
		| Z-Score: | 
		0.4252±0.0446836 | 
	 
	
		| p-Value: | 
		0.670874 | 
	 
	
		| Z-Factor: | 
		-1.98611 | 
	 
	
		| Fitness Defect: | 
		0.3992 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 7|C10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.60 Celcius |  | Date: | 2006-03-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.0387±0.00173 |  | Plate DMSO Control (-): | 0.43385±0.01884 |  | Plate Z-Factor: | 0.8013 |  
  |  png ps pdf |  
 
 
	
		| 2754253 | 
		[(3S,10R,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 3433010 | 
		methyl 4-(3-acetyloxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17 -yl)pentanoate | 
	 
	
		| 4145844 | 
		[6-(3-acetyloxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1 7-yl)-2-methyl-heptan-3-yl] acetate | 
	 
	
		| 6560376 | 
		[(3S,8R,9S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6710760 | 
		[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyc lopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 7118127 | 
		[(3S,8S,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 2 |  |   
 |  active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |