| Compound Information | SONAR Target prediction | | Name: | 7-OXOCHOLESTERYL ACETATE | | Unique Identifier: | SPE00307035 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 396.309 g/mol | | X log p: | 2.529 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3C(CCC12C)C1(C)CCC(CC1=CC3=O)OC(C)=O | | Class: | sterol | | Source: | Cliona copiosa | | Reference: | J Nat Prod 55:1588 (1992) |
| Species: |
4932 |
| Condition: |
PEX11 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6773±0.00480833 |
| Normalized OD Score: sc h |
0.9817±0.00789717 |
| Z-Score: |
-1.0497±0.370375 |
| p-Value: |
0.310234 |
| Z-Factor: |
-3.82878 |
| Fitness Defect: |
1.1704 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 7|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2007-10-23 YYYY-MM-DD | | Plate CH Control (+): | 0.039±0.00125 | | Plate DMSO Control (-): | 0.6799±0.01498 | | Plate Z-Factor: | 0.9172 |
| png ps pdf |
| 2754253 |
[(3S,10R,13R)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-3-yl] acetate |
| 3433010 |
methyl 4-(3-acetyloxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17 -yl)pentanoate |
| 4145844 |
[6-(3-acetyloxy-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1 7-yl)-2-methyl-heptan-3-yl] acetate |
| 6560376 |
[(3S,8R,9S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| 6710760 |
[(3S,10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyc lopenta[a]phenanthren-3-yl] acetate |
| 7118127 |
[(3S,8S,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,1 6,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|