Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
HHF1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6689±0.00650538 |
Normalized OD Score: sc h |
0.9938±0.00950862 |
Z-Score: |
-0.2757±0.430481 |
p-Value: |
0.769478 |
Z-Factor: |
-131.204 |
Fitness Defect: |
0.262 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-04-15 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00060 | Plate DMSO Control (-): | 0.678875±0.02334 | Plate Z-Factor: | 0.8947 |
| png ps pdf |
11786 |
[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cy clopenta[a]phenanthren-3-yl] acetate |
15921 |
[17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate |
99469 |
[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14 ,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
102150 |
[(3S,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
102203 |
[(3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclo penta[a]phenanthren-17-yl] acetate |
102205 |
[(3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
nonactive | Cluster 15449 | Additional Members: 9 | Rows returned: 2 | |
|