| Compound Information | SONAR Target prediction |  | Name: | CHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307031  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 380.309 g/mol |  | X log p: | 3.511  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | animal tissue; derivative |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		TEP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6268±0.00282843 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0216±0.00675256 | 
	 
	
		| Z-Score: | 
		0.5825±0.215382 | 
	 
	
		| p-Value: | 
		0.564786 | 
	 
	
		| Z-Factor: | 
		-5.03814 | 
	 
	
		| Fitness Defect: | 
		0.5713 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|D3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.40 Celcius |  | Date: | 2005-12-23 YYYY-MM-DD |  | Plate CH Control (+): | 0.038825±0.00155 |  | Plate DMSO Control (-): | 0.601325±0.02069 |  | Plate Z-Factor: | 0.8832 |  
  |  png ps pdf |  
 
 
	
		| 11786 | 
		[(3S,9S,14S,17R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cy clopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 15921 | 
		[17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate | 
	 
	
		| 99469 | 
		[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14 ,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 102150 | 
		[(3S,8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate | 
	 
	
		| 102203 | 
		[(3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-10,13,17-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclo penta[a]phenanthren-17-yl] acetate | 
	 
	
		| 102205 | 
		[(3S,8R,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 7 | << Back 1 2 |   
 |  active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |