Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
RPA49 |
Replicates: |
2 |
Raw OD Value: r im |
0.6297±0.039103 |
Normalized OD Score: sc h |
1.0018±0.0181499 |
Z-Score: |
0.0484±0.634585 |
p-Value: |
0.654012 |
Z-Factor: |
-27.141 |
Fitness Defect: |
0.4246 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-12-13 YYYY-MM-DD | Plate CH Control (+): | 0.040675±0.00046 | Plate DMSO Control (-): | 0.6039±0.01345 | Plate Z-Factor: | 0.9188 |
| png ps pdf |
625040 |
(17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl) acetate |
626535 |
(10,13-dimethyl-17-prop-1-en-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren- 3-yl) acetate |
628486 |
(17-butan-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl ) acetate |
630017 |
[17-(1-formyloxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanth ren-3-yl] acetate |
631754 |
[10,13-dimethyl-17-(5-methylhex-4-en-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phe nanthren-3-yl] acetate |
632581 |
[17-(2-hydroxy-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclope nta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|