Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
MED2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5470±0.00318198 |
Normalized OD Score: sc h |
0.9813±0.00739716 |
Z-Score: |
-0.8280±0.313279 |
p-Value: |
0.419052 |
Z-Factor: |
-5.62053 |
Fitness Defect: |
0.8698 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.041275000000000006±0.00066 | Plate DMSO Control (-): | 0.5435±0.01708 | Plate Z-Factor: | 0.8892 |
| png ps pdf |
540889 |
(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) acetate |
541139 |
(3-acetyloxy-4,4,10,13-tetramethyl-1,2,3,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17- yl) acetate |
547784 |
[17-(2-hydroxypropan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phen anthren-3-yl] acetate |
570648 |
[10,13-dimethyl-17-(3,4,5,6-tetramethylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclope nta[a]phenanthren-3-yl] acetate |
583593 |
(4a-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl) acetate |
583605 |
n/a |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|