Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
SWE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7784±0.0247487 |
Normalized OD Score: sc h |
1.0064±0.000927389 |
Z-Score: |
0.4719±0.0106415 |
p-Value: |
0.637008 |
Z-Factor: |
-2.197 |
Fitness Defect: |
0.451 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.60 Celcius | Date: | 2006-04-19 YYYY-MM-DD | Plate CH Control (+): | 0.0377±0.00108 | Plate DMSO Control (-): | 0.7609499999999999±0.01963 | Plate Z-Factor: | 0.9255 |
| png ps pdf |
11944667 |
[(3R,7S,8S,9R,10S,13S,14S,17R)-17-[(E,2S,5S)-5,6-dimethylhept-3-en-2-yl]-7,10,13-trimethyl-2,3,4,7,8,9,1 1,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
11944668 |
[(3R,7R,8S,9R,10S,13S,14S,17R)-17-[(E,2S,5S)-5,6-dimethylhept-3-en-2-yl]-7,10,13-trimethyl-2,3,4,7,8,9,1 1,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|