| 
 | Compound Information | SONAR Target prediction |  | Name: | CHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307031 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 380.309 g/mol |  | X log p: | 3.511  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | animal tissue; derivative | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BEM2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4684±0.00289914 |  
		| Normalized OD Score: sc h | 0.9808±0.0220068 |  
		| Z-Score: | -0.4290±1.17135 |  
		| p-Value: | 0.449172 |  
		| Z-Factor: | -12.9673 |  
		| Fitness Defect: | 0.8003 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 14|F6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.40 Celcius |  | Date: | 2008-02-05 YYYY-MM-DD |  | Plate CH Control (+): | 0.041275000000000006±0.00251 |  | Plate DMSO Control (-): | 0.47387500000000005±0.01471 |  | Plate Z-Factor: | 0.8726 | 
 |  png ps
 pdf
 | 
 
 
	
		| 11944667 | [(3R,7S,8S,9R,10S,13S,14S,17R)-17-[(E,2S,5S)-5,6-dimethylhept-3-en-2-yl]-7,10,13-trimethyl-2,3,4,7,8,9,1 1,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
 |  
		| 11944668 | [(3R,7R,8S,9R,10S,13S,14S,17R)-17-[(E,2S,5S)-5,6-dimethylhept-3-en-2-yl]-7,10,13-trimethyl-2,3,4,7,8,9,1 1,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >> | 
 
 | active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  | 
 
 |