| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
ASF1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5924±0.00367696 |
| Normalized OD Score: sc h |
0.9996±0.015251 |
| Z-Score: |
-0.0220±0.645611 |
| p-Value: |
0.648098 |
| Z-Factor: |
-196.872 |
| Fitness Defect: |
0.4337 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 14|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.90 Celcius | | Date: | 2008-01-30 YYYY-MM-DD | | Plate CH Control (+): | 0.042875±0.00085 | | Plate DMSO Control (-): | 0.566675±0.01613 | | Plate Z-Factor: | 0.9043 |
| png ps pdf |
| 7568314 |
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7568318 |
[(3S,8S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7801631 |
[(3S,8S,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7801632 |
[(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-pentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7801646 |
[(3S,8S,9R,10R,13R,14S,17S)-10,13-dimethyl-17-[(2S)-pentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7801647 |
[(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-[(2S)-pentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|