| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
DIA2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6122±0.00756604 |
| Normalized OD Score: sc h |
0.9831±0.00762887 |
| Z-Score: |
-0.7697±0.320555 |
| p-Value: |
0.453082 |
| Z-Factor: |
-7.35774 |
| Fitness Defect: |
0.7917 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 14|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2008-06-18 YYYY-MM-DD | | Plate CH Control (+): | 0.03985±0.00080 | | Plate DMSO Control (-): | 0.60145±0.01562 | | Plate Z-Factor: | 0.9133 |
| png ps pdf |
| 7359793 |
[(3S,8S,9R,10R,13R,14S,17R)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7359794 |
[(3S,8S,9R,10R,13R,14S,17R)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7359796 |
[(3S,8S,9R,10R,13R,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7359798 |
[(3S,8S,9R,10R,13R,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7568308 |
[(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 7568311 |
[(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|