Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7071±0.000494975 |
Normalized OD Score: sc h |
1.0116±0.00441167 |
Z-Score: |
0.6313±0.230151 |
p-Value: |
0.5333 |
Z-Factor: |
-6.94494 |
Fitness Defect: |
0.6287 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.70 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.041374999999999995±0.00052 | Plate DMSO Control (-): | 0.687425±0.02326 | Plate Z-Factor: | 0.8902 |
| png ps pdf |
7359793 |
[(3S,8S,9R,10R,13R,14S,17R)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
7359794 |
[(3S,8S,9R,10R,13R,14S,17R)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
7359796 |
[(3S,8S,9R,10R,13R,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
7359798 |
[(3S,8S,9R,10R,13R,14S,17S)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
7568308 |
[(3S,8S,9R,10R,13R,14S,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
7568311 |
[(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|