| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
SLT2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8435±0.00296985 |
| Normalized OD Score: sc h |
0.9900±0.00233349 |
| Z-Score: |
0.6541±0.114 |
| p-Value: |
0.514406 |
| Z-Factor: |
-4.15308 |
| Fitness Defect: |
0.6647 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 22|B9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.08325±0.00411 | | Plate DMSO Control (-): | 0.9702500000000001±0.02742 | | Plate Z-Factor: | 0.9018 |
|  png
ps
pdf |
| 7213835 |
[(3R,8S,9R,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl
openta[a]phenanthren-17-yl] acetate |
| 7213837 |
[(3S,8S,9R,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl
openta[a]phenanthren-17-yl] acetate |
| 7314324 |
[(3S,8R,9R,10R,13S,14S,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-yl] acetate |
| 7314325 |
[(3S,8R,9R,10R,13S,14S,17S)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-yl] acetate |
| 7314326 |
[(3S,8R,9R,10R,13S,14R,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-yl] acetate |
| 7314327 |
[(3S,8R,9R,10R,13S,14R,17S)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|
