Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7079±0.000777817 |
Normalized OD Score: sc h |
0.9851±0.00233459 |
Z-Score: |
-0.8560±0.152805 |
p-Value: |
0.394752 |
Z-Factor: |
-6.27249 |
Fitness Defect: |
0.9295 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.04055±0.00053 | Plate DMSO Control (-): | 0.705825±0.02136 | Plate Z-Factor: | 0.8974 |
| png ps pdf |
7213835 |
[(3R,8S,9R,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
7213837 |
[(3S,8S,9R,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
7314324 |
[(3S,8R,9R,10R,13S,14S,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-yl] acetate |
7314325 |
[(3S,8R,9R,10R,13S,14S,17S)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-yl] acetate |
7314326 |
[(3S,8R,9R,10R,13S,14R,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-yl] acetate |
7314327 |
[(3S,8R,9R,10R,13S,14R,17S)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|