Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
DOC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5209±0.0195161 |
Normalized OD Score: sc h |
0.9689±0.00785402 |
Z-Score: |
-1.1001±0.322551 |
p-Value: |
0.283636 |
Z-Factor: |
-5.42791 |
Fitness Defect: |
1.2601 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2008-05-09 YYYY-MM-DD | Plate CH Control (+): | 0.0408±0.00085 | Plate DMSO Control (-): | 0.54085±0.02025 | Plate Z-Factor: | 0.8504 |
| png ps pdf |
7087013 |
[(3S,8R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
7092588 |
[(3S,8S,9R,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
7092589 |
[(3S,8S,9S,10R,13S,14R,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
7092590 |
[(3S,8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
7093897 |
[(3R,8S,9S,10R,13S,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
7093898 |
[(3S,8S,9S,10R,13S,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|