Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
RIC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4846±0.0324562 |
Normalized OD Score: sc h |
1.0841±0.00559814 |
Z-Score: |
1.0408±0.253988 |
p-Value: |
0.305728 |
Z-Factor: |
-0.726849 |
Fitness Defect: |
1.1851 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2006-03-17 YYYY-MM-DD | Plate CH Control (+): | 0.0394±0.00176 | Plate DMSO Control (-): | 0.463975±0.02140 | Plate Z-Factor: | 0.7790 |
| png ps pdf |
7052859 |
[(3S,8S,9R,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052860 |
[(3S,8S,9R,10R,13S,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052861 |
[(3S,8S,9R,10R,13R,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052862 |
[(3S,8S,9R,10R,13R,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
7052930 |
[(1S)-1-[(3R,5S,8R,9R,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
7052931 |
[(1S)-1-[(3R,5S,8R,9S,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|