| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
BEM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4684±0.00289914 |
| Normalized OD Score: sc h |
0.9808±0.0220068 |
| Z-Score: |
-0.4290±1.17135 |
| p-Value: |
0.449172 |
| Z-Factor: |
-12.9673 |
| Fitness Defect: |
0.8003 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 14|F6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.40 Celcius | | Date: | 2008-02-05 YYYY-MM-DD | | Plate CH Control (+): | 0.041275000000000006±0.00251 | | Plate DMSO Control (-): | 0.47387500000000005±0.01471 | | Plate Z-Factor: | 0.8726 |
| png ps pdf |
| 7052859 |
[(3S,8S,9R,10R,13S,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
| 7052860 |
[(3S,8S,9R,10R,13S,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
| 7052861 |
[(3S,8S,9R,10R,13R,14S,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
| 7052862 |
[(3S,8S,9R,10R,13R,14R,17E)-17-ethylidene-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
| 7052930 |
[(1S)-1-[(3R,5S,8R,9R,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
| 7052931 |
[(1S)-1-[(3R,5S,8R,9S,10R,17R)-3-acetyloxy-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocycl openta[a]phenanthren-17-yl]ethyl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|