Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
HSC82 |
Replicates: |
2 |
Raw OD Value: r im |
0.7351±0.00254558 |
Normalized OD Score: sc h |
1.0002±0.000567759 |
Z-Score: |
0.0098±0.0274784 |
p-Value: |
0.984498 |
Z-Factor: |
-60.7695 |
Fitness Defect: |
0.0156 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 14|F6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00163 | Plate DMSO Control (-): | 0.7135499999999999±0.00913 | Plate Z-Factor: | 0.9462 |
| png ps pdf |
104667 |
[(3S,8R,9S,10R,13S,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl] acetate |
222529 |
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phena nthren-3-yl] acetate |
248979 |
[(3S,8R,9S,10R,13R,14S,16R)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-16-yl] acetate |
248980 |
[(3S,8R,9S,10R,13R,14S,16S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-16-yl] acetate |
255265 |
n/a |
261862 |
n/a |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|