| Compound Information | SONAR Target prediction |  | Name: | CHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307031  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 380.309 g/mol |  | X log p: | 3.511  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | animal tissue; derivative |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ABP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6916±0.00615183 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9883±0.00268174 | 
	 
	
		| Z-Score: | 
		-0.6021±0.112823 | 
	 
	
		| p-Value: | 
		0.548394 | 
	 
	
		| Z-Factor: | 
		-9.42588 | 
	 
	
		| Fitness Defect: | 
		0.6008 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 14|F6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.90 Celcius |  | Date: | 2007-12-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.041550000000000004±0.00041 |  | Plate DMSO Control (-): | 0.680525±0.01263 |  | Plate Z-Factor: | 0.9449 |  
  |  png ps pdf |  
 
 
	
		| 6552133 | 
		[(3R,8S,9R,10S,13S,14S,17R)-17-(1-hydroxyethyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6560413 | 
		[(3S,8R,9S,10S,13S,14R,17R)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,1 4,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6566118 | 
		[(3R,7R,8S,9R,10S,13R,14R,17R)-17-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-7,10,13-trimethyl-2,3,4,7,8,9,1 1,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6567542 | 
		[(3S,8R,9S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6572267 | 
		[(3S,8R,9S,10S,13S,14R,17S)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6572818 | 
		[(3S,6aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,8a,11,11,14a-octamethyl-1,2,3,6,6a,7,8,9,10,12,12a,13,14, 14b-tetradecahydropicen-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >>  |   
 |  active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |