| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
RPL9B |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8104±0.00763675 |
| Normalized OD Score: sc h |
1.0154±0.0141326 |
| Z-Score: |
0.4685±0.443266 |
| p-Value: |
0.65551 |
| Z-Factor: |
-3.34588 |
| Fitness Defect: |
0.4223 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.30 Celcius | | Date: | 2006-03-10 YYYY-MM-DD | | Plate CH Control (+): | 0.039125±0.00093 | | Plate DMSO Control (-): | 0.7981750000000001±0.01371 | | Plate Z-Factor: | 0.9491 |
|  png
ps
pdf |
| 6432810 |
[(3S,10R,13R)-17-[(2S)-5-ethyl-6-methyl-hept-5-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dod
ecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6432811 |
[(3S,10R,13R)-17-[(2S)-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy
dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6437330 |
[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2S,5S)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11
,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6545505 |
[(3R,8R,9S,10R,13R,14S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo
penta[a]phenanthren-3-yl] acetate |
| 6547272 |
[(3S,8R,9R,10S,13R,14S,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-yl] acetate |
| 6552006 |
[(3R,8S,9S,10R,13S,14R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenant
hren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|
