Compound Information | SONAR Target prediction | Name: | CHOLESTERYL ACETATE | Unique Identifier: | SPE00307031 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 380.309 g/mol | X log p: | 3.511 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 7 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | Class: | sterol | Source: | animal tissue; derivative |
Species: |
4932 |
Condition: |
POL32 |
Replicates: |
2 |
Raw OD Value: r im |
0.5945±0.00714178 |
Normalized OD Score: sc h |
1.0297±0.00213203 |
Z-Score: |
0.8276±0.0592363 |
p-Value: |
0.408322 |
Z-Factor: |
-1.65474 |
Fitness Defect: |
0.8957 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 5|D3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.60 Celcius | Date: | 2006-02-16 YYYY-MM-DD | Plate CH Control (+): | 0.039175±0.00093 | Plate DMSO Control (-): | 0.576325±0.01737 | Plate Z-Factor: | 0.9157 |
| png ps pdf |
6432810 |
[(3S,10R,13R)-17-[(2S)-5-ethyl-6-methyl-hept-5-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6432811 |
[(3S,10R,13R)-17-[(2S)-5,6-dimethylhept-6-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6437330 |
[(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2S,5S)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11 ,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6545505 |
[(3R,8R,9S,10R,13R,14S,17R)-17-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-yl] acetate |
6547272 |
[(3S,8R,9R,10S,13R,14S,17R)-17-acetyloxy-3,10,13-trimethyl-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocycl openta[a]phenanthren-3-yl] acetate |
6552006 |
[(3R,8S,9S,10R,13S,14R)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenant hren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|