| Compound Information | SONAR Target prediction |  | Name: | CHOLESTERYL ACETATE |  | Unique Identifier: | SPE00307031  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 380.309 g/mol |  | X log p: | 3.511  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O |  | Class: | sterol |  | Source: | animal tissue; derivative |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		YPT6 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7160±0.00113137 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0134±0.00509154 | 
	 
	
		| Z-Score: | 
		0.4464±0.148959 | 
	 
	
		| p-Value: | 
		0.657098 | 
	 
	
		| Z-Factor: | 
		-3.84538 | 
	 
	
		| Fitness Defect: | 
		0.4199 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 5|D3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.10 Celcius |  | Date: | 2006-02-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.040575±0.00094 |  | Plate DMSO Control (-): | 0.694±0.01122 |  | Plate Z-Factor: | 0.9412 |  
  |  png ps pdf |  
 
 
	
		| 6427287 | 
		[(3S,10R,13R)-10,13-dimethyl-17-[(E,2R)-6-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydr o-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6427290 | 
		[(3S,10R,13R)-10,13-dimethyl-17-[(E,2R)-4,5,6-trimethylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dod ecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6427327 | 
		[(3S,10R,13R)-10,13-dimethyl-17-[(E,2R)-5-methylhept-3-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydr o-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6427329 | 
		[10,13-dimethyl-17-[(E)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclop enta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6427343 | 
		[(3S,10R,13R)-17-[(E,2S)-5,6-dimethylhept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodeca hydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 6427344 | 
		[(3S,10R,13R)-17-[(E,2S)-5-ethyl-6-methyl-hept-4-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-d odecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >>  |   
 |  active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 |  |  
  
 |