| Compound Information | SONAR Target prediction | | Name: | CHOLESTERYL ACETATE | | Unique Identifier: | SPE00307031 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 380.309 g/mol | | X log p: | 3.511 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(C)=O | | Class: | sterol | | Source: | animal tissue; derivative |
| Species: |
4932 |
| Condition: |
SEC22 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6867±0.0274357 |
| Normalized OD Score: sc h |
1.0277±0.00309197 |
| Z-Score: |
0.9632±0.152618 |
| p-Value: |
0.33826 |
| Z-Factor: |
-2.48085 |
| Fitness Defect: |
1.0839 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 5|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2007-10-16 YYYY-MM-DD | | Plate CH Control (+): | 0.039625±0.00105 | | Plate DMSO Control (-): | 0.657025±0.02787 | | Plate Z-Factor: | 0.8540 |
| png ps pdf |
| 5354503 |
[(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,1 4,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| 5363284 |
[17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cy clopenta[a]phenanthren-3-yl] acetate |
| 5378149 |
[(17E)-10,13-dimethyl-17-(6-methylheptan-2-ylidene)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a ]phenanthren-3-yl] acetate |
| 5378730 |
[17-[(Z)-but-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenant hren-3-yl] acetate |
| 5379188 |
[17-[(Z)-hex-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenant hren-3-yl] acetate |
| 5379343 |
[17-[(Z)-hept-2-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenan thren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 15449 | Additional Members: 9 | Rows returned: 0 | |
|