Compound Information | SONAR Target prediction | Name: | CHRYSOPHANOL | Unique Identifier: | SPE00300545 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 9.805 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cccc3c(=O)c2c1 | Class: | anthraquinone | Source: | Cassia and Rumex spp | Reference: | Phytochemistry 11: 2122 (1972) |
Species: |
4932 |
Condition: |
SPE00305025 |
Replicates: |
2 |
Raw OD Value: r im |
0.1122±0 |
Normalized OD Score: sc h |
0.3590±0 |
Z-Score: |
-13.9467±0 |
p-Value: |
3.36312e-44 |
Z-Factor: |
0.842868 |
Fitness Defect: |
100.1009 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|F5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.04±0.00200 | Plate DMSO Control (-): | 0.31255±0.01038 | Plate Z-Factor: | 0.8624 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10208 |
1,8-dihydroxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 | |
|