| Compound Information | SONAR Target prediction | | Name: | CHRYSOPHANOL | | Unique Identifier: | SPE00300545 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 9.805 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cccc3c(=O)c2c1 | | Class: | anthraquinone | | Source: | Cassia and Rumex spp | | Reference: | Phytochemistry 11: 2122 (1972) |
| Species: |
4932 |
| Condition: |
YPT6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2811±0.0130108 |
| Normalized OD Score: sc h |
0.8568±0.0201776 |
| Z-Score: |
-4.0084±0.569864 |
| p-Value: |
0.000160955 |
| Z-Factor: |
-0.255033 |
| Fitness Defect: |
8.7344 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|D8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2006-02-22 YYYY-MM-DD | | Plate CH Control (+): | 0.040875±0.00108 | | Plate DMSO Control (-): | 0.33375±0.01630 | | Plate Z-Factor: | 0.7447 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 10208 |
1,8-dihydroxy-3-methyl-anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 | |
|
