| 
 | Compound Information | SONAR Target prediction |  | Name: | CHRYSOPHANOL |  | Unique Identifier: | SPE00300545 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 244.158 g/mol |  | X log p: | 9.805  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 34.14 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cccc3c(=O)c2c1 |  | Class: | anthraquinone |  | Source: | Cassia and Rumex spp |  | Reference: | Phytochemistry 11: 2122 (1972) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | RBL2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7075±0.000636396 |  
		| Normalized OD Score: sc h | 0.9956±0.00162235 |  
		| Z-Score: | -0.2476±0.0884816 |  
		| p-Value: | 0.804846 |  
		| Z-Factor: | -301.275 |  
		| Fitness Defect: | 0.2171 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 16|B7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2008-06-03 YYYY-MM-DD |  | Plate CH Control (+): | 0.040325±0.00067 |  | Plate DMSO Control (-): | 0.70045±0.01370 |  | Plate Z-Factor: | 0.9442 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 10208 | 1,8-dihydroxy-3-methyl-anthracene-9,10-dione |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 |  | 
 
 |