Compound Information | SONAR Target prediction | Name: | CHRYSOPHANOL | Unique Identifier: | SPE00300545 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 9.805 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cccc3c(=O)c2c1 | Class: | anthraquinone | Source: | Cassia and Rumex spp | Reference: | Phytochemistry 11: 2122 (1972) |
Species: |
4932 |
Condition: |
CLA4 |
Replicates: |
2 |
Raw OD Value: r im |
0.7011±0.0140714 |
Normalized OD Score: sc h |
1.0224±0.0241989 |
Z-Score: |
1.0100±1.10513 |
p-Value: |
0.446224 |
Z-Factor: |
-6.25013 |
Fitness Defect: |
0.8069 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2007-09-12 YYYY-MM-DD | Plate CH Control (+): | 0.04025±0.00093 | Plate DMSO Control (-): | 0.67225±0.02596 | Plate Z-Factor: | 0.8920 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10208 |
1,8-dihydroxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 | |
|