Compound Information | SONAR Target prediction | Name: | QUERCETIN TETRAMETHYL (5,7,3-,4-) ETHER | Unique Identifier: | SPE00300538 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 340.199 g/mol | X log p: | 12.502 (online calculus) | Lipinksi Failures | 1 | TPSA | 63.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(OC)c2C(=O)C(O)=C(Oc2c1)c1ccc(OC)c(OC)c1 | Class: | flavone | Source: | Sterculia foetida |
Species: |
4932 |
Condition: |
SWE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.1260±0.0126572 |
Normalized OD Score: sc h |
0.5291±0.0148736 |
Z-Score: |
-24.9066±1.58205 |
p-Value: |
0 |
Z-Factor: |
0.849374 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|D4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2006-04-19 YYYY-MM-DD | Plate CH Control (+): | 0.037950000000000005±0.00367 | Plate DMSO Control (-): | 0.721025±0.01932 | Plate Z-Factor: | 0.9209 |
| png ps pdf |
DBLink | Rows returned: 1 | |
97142 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
nonactive | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|