Compound Information | SONAR Target prediction | Name: | QUERCETIN TETRAMETHYL (5,7,3-,4-) ETHER | Unique Identifier: | SPE00300538 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 340.199 g/mol | X log p: | 12.502 (online calculus) | Lipinksi Failures | 1 | TPSA | 63.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1cc(OC)c2C(=O)C(O)=C(Oc2c1)c1ccc(OC)c(OC)c1 | Class: | flavone | Source: | Sterculia foetida |
Species: |
4932 |
Condition: |
SLT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5187±0.0575585 |
Normalized OD Score: sc h |
0.6693±0.0675505 |
Z-Score: |
-16.3237±3.36249 |
p-Value: |
1.68156e-44 |
Z-Factor: |
0.292584 |
Fitness Defect: |
100.794 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|D4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2006-03-21 YYYY-MM-DD | Plate CH Control (+): | 0.038425±0.00100 | Plate DMSO Control (-): | 0.7483500000000001±0.00817 | Plate Z-Factor: | 0.9533 |
| png ps pdf |
DBLink | Rows returned: 1 | |
97142 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy-chromen-4-one |
internal high similarity DBLink | Rows returned: 9 | << Back 1 2 |
active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|