| Compound Information | SONAR Target prediction | | Name: | QUERCETIN TETRAMETHYL (5,7,3-,4-) ETHER | | Unique Identifier: | SPE00300538 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 340.199 g/mol | | X log p: | 12.502 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 63.22 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(OC)c2C(=O)C(O)=C(Oc2c1)c1ccc(OC)c(OC)c1 | | Class: | flavone | | Source: | Sterculia foetida |
| Species: |
4932 |
| Condition: |
PEX11 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5662±0.0123037 |
| Normalized OD Score: sc h |
0.8134±0.0144437 |
| Z-Score: |
-10.8758±0.0888658 |
| p-Value: |
1.87055e-27 |
| Z-Factor: |
0.289448 |
| Fitness Defect: |
61.5436 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|D4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.90 Celcius | | Date: | 2007-10-23 YYYY-MM-DD | | Plate CH Control (+): | 0.039075±0.00031 | | Plate DMSO Control (-): | 0.6902250000000001±0.01999 | | Plate Z-Factor: | 0.9049 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 97142 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | << Back 1 2 |
| active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|