| Compound Information | SONAR Target prediction | | Name: | QUERCETIN TETRAMETHYL (5,7,3-,4-) ETHER | | Unique Identifier: | SPE00300538 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 340.199 g/mol | | X log p: | 12.502 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 63.22 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1cc(OC)c2C(=O)C(O)=C(Oc2c1)c1ccc(OC)c(OC)c1 | | Class: | flavone | | Source: | Sterculia foetida |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8300±0.0182434 |
| Normalized OD Score: sc h |
0.5924±0.0238473 |
| Z-Score: |
-14.3850±0.211639 |
| p-Value: |
0 |
| Z-Factor: |
0.747589 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 17|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09200000000000001±0.00690 | | Plate DMSO Control (-): | 0.96±0.02537 | | Plate Z-Factor: | 0.8825 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 97142 |
2-(3,4-dimethoxyphenyl)-3-hydroxy-5,7-dimethoxy-chromen-4-one |
| internal high similarity DBLink | Rows returned: 9 | << Back 1 2 |
| active | Cluster 6267 | Additional Members: 3 | Rows returned: 1 | |
|