Compound Information | SONAR Target prediction | Name: | 5,7,4`-TRIMETHOXYFLAVONE | Unique Identifier: | SPE00300384 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16O5 | Molecular Weight: | 296.19 g/mol | X log p: | 15.756 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 | Source: | ex Cassia siamia, Citrus reticulata | Reference: | Phytochemistry 22: 625 (1983) |
Species: |
4932 |
Condition: |
MDH1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8157±0.0365574 |
Normalized OD Score: sc h |
1.0143±0.011406 |
Z-Score: |
0.7846±0.560357 |
p-Value: |
0.467692 |
Z-Factor: |
-7.43093 |
Fitness Defect: |
0.7599 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.20 Celcius | Date: | 2007-08-07 YYYY-MM-DD | Plate CH Control (+): | 0.041225±0.00137 | Plate DMSO Control (-): | 0.7885249999999999±0.23569 | Plate Z-Factor: | -0.0622 |
| png ps pdf |
DBLink | Rows returned: 3 | |
79730 |
5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
161172 |
2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one |
6728945 |
7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 20 | 1 2 3 4 Next >> |
nonactive | Cluster 4262 | Additional Members: 9 | Rows returned: 4 | |
|