| Compound Information | SONAR Target prediction |  | Name: | 5,7,4`-TRIMETHOXYFLAVONE |  | Unique Identifier: | SPE00300384  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C18H16O5 |  | Molecular Weight: | 296.19 g/mol |  | X log p: | 15.756  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 53.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 |  | Source: | ex Cassia siamia, Citrus reticulata |  | Reference: | Phytochemistry 22: 625 (1983) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		HOC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5805±0.00608112 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9678±0.00159414 | 
	 
	
		| Z-Score: | 
		-1.0741±0.0933653 | 
	 
	
		| p-Value: | 
		0.283812 | 
	 
	
		| Z-Factor: | 
		-1.39246 | 
	 
	
		| Fitness Defect: | 
		1.2594 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 22|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.70 Celcius |  | Date: | 2006-02-14 YYYY-MM-DD |  | Plate CH Control (+): | 0.039825±0.00234 |  | Plate DMSO Control (-): | 0.5938±0.02154 |  | Plate Z-Factor: | 0.8713 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 79730 | 
		5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one | 
	 
	
		| 161172 | 
		2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one | 
	 
	
		| 6728945 | 
		7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 20 | 1 2 3 4 Next >>  |   
 |  nonactive | Cluster 4262 | Additional Members: 9 | Rows returned: 4 |  |   
 
 |