| Compound Information | SONAR Target prediction | | Name: | 5,7,4`-TRIMETHOXYFLAVONE | | Unique Identifier: | SPE00300384 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C18H16O5 | | Molecular Weight: | 296.19 g/mol | | X log p: | 15.756 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 53.99 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 | | Source: | ex Cassia siamia, Citrus reticulata | | Reference: | Phytochemistry 22: 625 (1983) |
| Species: |
4932 |
| Condition: |
PPH21 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7899±0.00876812 |
| Normalized OD Score: sc h |
0.9842±0.000645172 |
| Z-Score: |
-0.5672±0.030859 |
| p-Value: |
0.570696 |
| Z-Factor: |
-6.88934 |
| Fitness Defect: |
0.5609 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 22|C3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2006-05-16 YYYY-MM-DD | | Plate CH Control (+): | 0.039525000000000005±0.00168 | | Plate DMSO Control (-): | 0.7893000000000001±0.02253 | | Plate Z-Factor: | 0.9115 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 79730 |
5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| 161172 |
2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one |
| 6728945 |
7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 20 | << Back 1 2 3 4 |
| active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|