| 
 | Compound Information | SONAR Target prediction |  | Name: | 5,7,4`-TRIMETHOXYFLAVONE |  | Unique Identifier: | SPE00300384 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C18H16O5 |  | Molecular Weight: | 296.19 g/mol |  | X log p: | 15.756  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 53.99 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 |  | Source: | ex Cassia siamia, Citrus reticulata |  | Reference: | Phytochemistry 22: 625 (1983) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SET2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7031±0.000565685 |  
		| Normalized OD Score: sc h | 0.9982±0.00164336 |  
		| Z-Score: | -0.1075±0.0966917 |  
		| p-Value: | 0.914612 |  
		| Z-Factor: | -7.72939 |  
		| Fitness Defect: | 0.0893 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 22|C3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.90 Celcius |  | Date: | 2007-11-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.04185±0.00056 |  | Plate DMSO Control (-): | 0.697025±0.20672 |  | Plate Z-Factor: | -0.0904 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 3 |  | 
 
	
		| 79730 | 5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |  
		| 161172 | 2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one |  
		| 6728945 | 7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one |  
 
 | active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 |  | 
 
 |