Compound Information | SONAR Target prediction | Name: | 5,7,4`-TRIMETHOXYFLAVONE | Unique Identifier: | SPE00300384 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16O5 | Molecular Weight: | 296.19 g/mol | X log p: | 15.756 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 | Source: | ex Cassia siamia, Citrus reticulata | Reference: | Phytochemistry 22: 625 (1983) |
Species: |
4932 |
Condition: |
SAP30 |
Replicates: |
2 |
Raw OD Value: r im |
0.6277±0.0066468 |
Normalized OD Score: sc h |
0.9496±0.0100664 |
Z-Score: |
-1.7998±0.493196 |
p-Value: |
0.0892218 |
Z-Factor: |
-1.26311 |
Fitness Defect: |
2.4166 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.039224999999999996±0.00206 | Plate DMSO Control (-): | 0.6526749999999999±0.01490 | Plate Z-Factor: | 0.9144 |
| png ps pdf |
DBLink | Rows returned: 3 | |
79730 |
5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
161172 |
2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one |
6728945 |
7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|