Compound Information | SONAR Target prediction | Name: | 5,7,4`-TRIMETHOXYFLAVONE | Unique Identifier: | SPE00300384 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H16O5 | Molecular Weight: | 296.19 g/mol | X log p: | 15.756 (online calculus) | Lipinksi Failures | 1 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cc(OC)cc(OC)c2C(=O)C=1 | Source: | ex Cassia siamia, Citrus reticulata | Reference: | Phytochemistry 22: 625 (1983) |
Species: |
4932 |
Condition: |
TFP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7161±0.000919239 |
Normalized OD Score: sc h |
0.9961±0.00544917 |
Z-Score: |
-0.1626±0.225612 |
p-Value: |
0.872488 |
Z-Factor: |
-9.23081 |
Fitness Defect: |
0.1364 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 22|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-08-31 YYYY-MM-DD | Plate CH Control (+): | 0.041075±0.00173 | Plate DMSO Control (-): | 0.6874±0.17424 | Plate Z-Factor: | 0.1037 |
| png ps pdf |
DBLink | Rows returned: 3 | |
79730 |
5,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
161172 |
2-(4-hydroxyphenyl)-5,7-dimethoxy-chromen-4-one |
6728945 |
7-hydroxy-5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 20 | 1 2 3 4 Next >> |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|