| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
MT2481-pdr1pdr3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7116±0.00106066 |
| Normalized OD Score: sc h |
1.0478±0.00403617 |
| Z-Score: |
1.5180±0.16341 |
| p-Value: |
0.131558 |
| Z-Factor: |
-0.446178 |
| Fitness Defect: |
2.0283 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2006-05-02 YYYY-MM-DD | | Plate CH Control (+): | 0.038275±0.00086 | | Plate DMSO Control (-): | 0.671375±0.01480 | | Plate Z-Factor: | 0.9244 |
|  png
ps
pdf |
| 86818 |
2-methyl-3-(4-propan-2-yl-1-cyclohexenyl)propanal |
| 92038 |
2-[(4-propan-2-yl-1-cyclohexenyl)methyl]cyclopentan-1-one |
| 95184 |
n/a |
| 98095 |
1-(1-cyclopent-2-enyl)propan-2-one |
| 101695 |
2-(2,6,6-trimethyl-1-cyclohex-2-enyl)acetaldehyde |
| 118111 |
3-(7,7-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)propanal |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|
