| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
TFP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7556±0.0152735 |
| Normalized OD Score: sc h |
1.0258±0.0151423 |
| Z-Score: |
1.0744±0.61811 |
| p-Value: |
0.327284 |
| Z-Factor: |
-5.27223 |
| Fitness Defect: |
1.1169 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2007-08-31 YYYY-MM-DD | | Plate CH Control (+): | 0.0421±0.00088 | | Plate DMSO Control (-): | 0.7059249999999999±0.03291 | | Plate Z-Factor: | 0.8435 |
|  png
ps
pdf |
| 5325222 |
(1S,5R)-bicyclo[3.2.1]oct-6-en-3-one |
| 5364962 |
(E)-5-butyl-2,2-dimethyl-undec-6-en-3-one |
| 5365623 |
(4E)-cyclonon-4-en-1-one |
| 5367622 |
n/a |
| 5367800 |
3-methyl-2-[(E)-pent-2-enyl]cyclopentan-1-one |
| 5367848 |
2-[(E)-oct-2-enyl]cyclopentan-1-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|
