Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
VPS5 |
Replicates: |
2 |
Raw OD Value: r im |
0.8498±0.00268701 |
Normalized OD Score: sc h |
1.0175±0.00488386 |
Z-Score: |
0.9529±0.259086 |
p-Value: |
0.348694 |
Z-Factor: |
-1.82541 |
Fitness Defect: |
1.0536 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2006-03-30 YYYY-MM-DD | Plate CH Control (+): | 0.03935±0.00181 | Plate DMSO Control (-): | 0.813625±0.01133 | Plate Z-Factor: | 0.9532 |
| png ps pdf |
3257327 |
3-acetyl-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
3513364 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthre n-3-one |
3737903 |
2-(6-methylhept-2-enyl)cyclohexan-1-one |
4033896 |
6,10,10-trimethylbicyclo[7.2.0]undec-5-en-2-one |
4087237 |
17-acetyl-10,13-dimethyl-1,2,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
4355207 |
2-[6-methyl-3-(3-methylbutyl)hept-2-enyl]cyclohexan-1-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|