| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
BNI1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7298±0.00509117 |
| Normalized OD Score: sc h |
1.0235±0.0000324209 |
| Z-Score: |
1.1600±0.0381201 |
| p-Value: |
0.246208 |
| Z-Factor: |
-3.00531 |
| Fitness Defect: |
1.4016 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2007-09-14 YYYY-MM-DD | | Plate CH Control (+): | 0.047825±0.01604 | | Plate DMSO Control (-): | 0.694225±0.01759 | | Plate Z-Factor: | 0.7638 |
| png ps pdf |
| 641583 |
(1R,2R,4S,5S)-2,4-dimethylbicyclo[3.2.1]oct-6-en-3-one |
| 641584 |
(1R,2S,4R,5S)-2,4-dimethylbicyclo[3.2.1]oct-6-en-3-one |
| 643234 |
1-[(1R,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethyl-propan-1-one |
| 3015312 |
cyclodec-4-en-1-one |
| 3034897 |
5,5-dimethyl-2,3,4,4a,6,7-hexahydro-1H-naphthalene-2-carbaldehyde |
| 3076365 |
(5R,8S,13R,14S,17S)-17-acetyl-5,13-dimethyl-1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenan thren-3-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|