Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
CLB2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7023±0.00558614 |
Normalized OD Score: sc h |
1.0175±0.0115369 |
Z-Score: |
1.0176±0.687819 |
p-Value: |
0.363938 |
Z-Factor: |
-5.22305 |
Fitness Defect: |
1.0108 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-11-02 YYYY-MM-DD | Plate CH Control (+): | 0.040650000000000006±0.00031 | Plate DMSO Control (-): | 0.6779999999999999±0.01990 | Plate Z-Factor: | 0.9077 |
| png ps pdf |
641583 |
(1R,2R,4S,5S)-2,4-dimethylbicyclo[3.2.1]oct-6-en-3-one |
641584 |
(1R,2S,4R,5S)-2,4-dimethylbicyclo[3.2.1]oct-6-en-3-one |
643234 |
1-[(1R,3aS,6aS)-1,2,3,3a,4,6a-hexahydropentalen-1-yl]-2,2-dimethyl-propan-1-one |
3015312 |
cyclodec-4-en-1-one |
3034897 |
5,5-dimethyl-2,3,4,4a,6,7-hexahydro-1H-naphthalene-2-carbaldehyde |
3076365 |
(5R,8S,13R,14S,17S)-17-acetyl-5,13-dimethyl-1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenan thren-3-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|