Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
SWE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7663±0.0157685 |
Normalized OD Score: sc h |
1.0450±0.000754519 |
Z-Score: |
1.3521±0.13266 |
p-Value: |
0.178252 |
Z-Factor: |
-0.832878 |
Fitness Defect: |
1.7246 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.20 Celcius | Date: | 2006-04-19 YYYY-MM-DD | Plate CH Control (+): | 0.03795±0.00367 | Plate DMSO Control (-): | 0.721025±0.01932 | Plate Z-Factor: | 0.9209 |
| png ps pdf |
585828 |
bicyclo[3.2.2]non-6-en-3-one |
608881 |
2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde |
609030 |
1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehy de |
615883 |
10,13-dimethyl-17-pentan-2-yl-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one |
634360 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-1,2,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]p henanthren-3-one |
638986 |
(2S)-2,5-dimethyl-2-(4-oxopentyl)cyclohept-4-en-1-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|