| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
KRE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8349±0.00806102 |
| Normalized OD Score: sc h |
1.0161±0.00153971 |
| Z-Score: |
0.8782±0.0688953 |
| p-Value: |
0.380424 |
| Z-Factor: |
-1.36559 |
| Fitness Defect: |
0.9665 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.20 Celcius | | Date: | 2006-01-31 YYYY-MM-DD | | Plate CH Control (+): | 0.038425±0.00059 | | Plate DMSO Control (-): | 0.797875±0.01035 | | Plate Z-Factor: | 0.9609 |
| png ps pdf |
| 585828 |
bicyclo[3.2.2]non-6-en-3-one |
| 608881 |
2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carbaldehyde |
| 609030 |
1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carbaldehy de |
| 615883 |
10,13-dimethyl-17-pentan-2-yl-1,2,3,4,5,6,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-12-one |
| 634360 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-1,2,4,5,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]p henanthren-3-one |
| 638986 |
(2S)-2,5-dimethyl-2-(4-oxopentyl)cyclohept-4-en-1-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|