Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
HTZ1 |
Replicates: |
2 |
Raw OD Value: r im |
0.2534±0.0704278 |
Normalized OD Score: sc h |
1.0160±0.0578708 |
Z-Score: |
0.1663±0.330808 |
p-Value: |
0.817544 |
Z-Factor: |
-28.6165 |
Fitness Defect: |
0.2015 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2007-09-26 YYYY-MM-DD | Plate CH Control (+): | 0.040125±0.00054 | Plate DMSO Control (-): | 0.23112500000000002±0.07705 | Plate Z-Factor: | -0.5197 |
| png ps pdf |
576614 |
1-(3,7,7-trimethyl-2-bicyclo[4.1.0]hept-3-enyl)propan-2-one |
577032 |
2-(4,7,7-trimethyl-2-bicyclo[3.1.1]hept-3-enyl)acetaldehyde |
577599 |
1-ethyl-5,8a-dimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-one |
579163 |
1-(2,6,6-trimethyl-1-cyclohex-2-enyl)propan-2-one |
579297 |
3-(2,6,6-trimethyl-1-cyclohexenyl)propanal |
583872 |
4-(3,3,5-trimethyl-4-bicyclo[4.1.0]hept-4-enyl)butan-2-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|