Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
RVS167 |
Replicates: |
2 |
Raw OD Value: r im |
0.7692±0.0277893 |
Normalized OD Score: sc h |
1.0252±0.0112487 |
Z-Score: |
1.4163±0.676659 |
p-Value: |
0.203228 |
Z-Factor: |
-2.32344 |
Fitness Defect: |
1.5934 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2007-11-14 YYYY-MM-DD | Plate CH Control (+): | 0.040650000000000006±0.00062 | Plate DMSO Control (-): | 0.745375±0.01666 | Plate Z-Factor: | 0.9307 |
| png ps pdf |
556383 |
bicyclo[3.2.1]oct-6-en-3-one |
556423 |
n/a |
561018 |
4-(7,7-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)butan-2-one |
561019 |
4-(7,7-dimethyl-3-bicyclo[4.1.0]hept-3-enyl)butan-2-one |
565535 |
2-(3-methyl-1-cyclohex-2-enyl)acetaldehyde |
565911 |
n/a |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|